Hydrazine,(2,4,6-trichloro-3,5-difluorophenyl)- structure
|
Common Name | Hydrazine,(2,4,6-trichloro-3,5-difluorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 7632-66-8 | Molecular Weight | 247.45700 | |
| Density | 1.763g/cm3 | Boiling Point | 246.5ºC at 760mmHg | |
| Molecular Formula | C6H3Cl3F2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,4,6-trichloro-3,5-difluorophenyl)hydrazine |
|---|
| Density | 1.763g/cm3 |
|---|---|
| Boiling Point | 246.5ºC at 760mmHg |
| Molecular Formula | C6H3Cl3F2N2 |
| Molecular Weight | 247.45700 |
| Exact Mass | 245.93300 |
| PSA | 38.05000 |
| LogP | 3.98390 |
| Index of Refraction | 1.622 |
| InChIKey | OYDUUZQOQYBLDD-UHFFFAOYSA-N |
| SMILES | NNc1c(Cl)c(F)c(Cl)c(F)c1Cl |
|
~49%
Hydrazine,(2,4,... CAS#:7632-66-8 |
| Literature: Allen, Scott E.; Mahatthananchai, Jessada; Bode, Jeffrey W.; Kozlowski, Marisa C. Journal of the American Chemical Society, 2012 , vol. 134, # 29 p. 12098 - 12103 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |