[1,1':2',1''-Terphenyl]-4'-carboxylicacid, 3',6'-dimethyl-5'-phenyl-, ethyl ester (9CI) structure
|
Common Name | [1,1':2',1''-Terphenyl]-4'-carboxylicacid, 3',6'-dimethyl-5'-phenyl-, ethyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 76331-32-3 | Molecular Weight | 406.51600 | |
| Density | 1.092g/cm3 | Boiling Point | 499.3ºC at 760 mmHg | |
| Molecular Formula | C29H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.6ºC | |
| Name | ethyl 2,5-dimethyl-3,4,6-triphenylbenzoate |
|---|
| Density | 1.092g/cm3 |
|---|---|
| Boiling Point | 499.3ºC at 760 mmHg |
| Molecular Formula | C29H26O2 |
| Molecular Weight | 406.51600 |
| Flash Point | 177.6ºC |
| Exact Mass | 406.19300 |
| PSA | 26.30000 |
| LogP | 7.48110 |
| Index of Refraction | 1.592 |
| InChIKey | WNEOWEAJYKIOLA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)c(-c2ccccc2)c(-c2ccccc2)c(C)c1-c1ccccc1 |
|
~86%
[1,1':2',1''-Te... CAS#:76331-32-3 |
| Literature: Bandyopadhyay, T. K.; Bhattacharya, A. J. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 6 p. 439 - 442 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |