Tropapride structure
|
Common Name | Tropapride | ||
|---|---|---|---|---|
| CAS Number | 76352-13-1 | Molecular Weight | 380.48000 | |
| Density | 1.2g/cm3 | Boiling Point | 511.2ºC at 760 mmHg | |
| Molecular Formula | C23H28N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263ºC | |
| Name | 4-(diethylamino)benzenediazonium,hexafluorophosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 511.2ºC at 760 mmHg |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.48000 |
| Flash Point | 263ºC |
| Exact Mass | 380.21000 |
| PSA | 50.80000 |
| LogP | 3.95800 |
| Index of Refraction | 1.608 |
| InChIKey | PCIWCYUKRZFCMF-YQQQUEKLSA-N |
| SMILES | COc1cccc(C(=O)NC2CC3CCC(C2)N3Cc2ccccc2)c1OC |
| HS Code | 2933990090 |
|---|
|
~%
Tropapride CAS#:76352-13-1 |
| Literature: Slowinski, Tomasz; Stefanowicz, Jacek; Dawidowski, MacIej; Kleps, Jerzy; Czuczwar, Stanislaw; Andres-Mach, Marta; Luszczki, Jarogniew J.; Nowak, Gabriel; Stachowicz, Katarzyna; Szewczyk, Bernadeta; Slawinska, Anna; Mazurek, Aleksander P.; Mazurek, Andrzej; Plucinski, Franciszek; Wolska, Irena; Herold, Franciszek European Journal of Medicinal Chemistry, 2011 , vol. 46, # 9 p. 4474 - 4488 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| p-Diazonium-N,hexafluorophosphate |
| EINECS 211-993-7 |