methyl 5-dimethylamino-4-phenyl-triazole-4-carboxylate
methyl 5-dimethylamino-4-phenyl-triazole-4-carboxylate structure
|
Common Name | methyl 5-dimethylamino-4-phenyl-triazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 76357-75-0 | Molecular Weight | 246.26500 | |
| Density | 1.22g/cm3 | Boiling Point | 333ºC at 760 mmHg | |
| Molecular Formula | C12H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 333ºC at 760 mmHg |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.26500 |
| Flash Point | 155.2ºC |
| Exact Mass | 246.11200 |
| PSA | 66.62000 |
| Index of Refraction | 1.595 |
| InChIKey | OCZDPJJVPHISMJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(c2ccccc2)N=NN=C1N(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~90%
methyl 5-dimeth... CAS#:76357-75-0 |
| Literature: Bernard, Christiane; Ghosez, Leon Journal of the Chemical Society, Chemical Communications, 1980 , # 20 p. 940 - 941 |
|
~%
methyl 5-dimeth... CAS#:76357-75-0 |
| Literature: Bernard, Christiane; Ghosez, Leon Journal of the Chemical Society, Chemical Communications, 1980 , # 20 p. 940 - 941 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate? |
| A: Related upstream materials(CAS) of methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate: 76357-70-5;18925-69-4. |
| Q: What is the SMILES notation of methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate? |
| A: SMILES notation of methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate is COC(=O)C1(c2ccccc2)N=NN=C1N(C)C. |
| Q: What is the English name of methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate? |
| A: The English name of methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate is methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate. |
| Q: What is the InChIKey of methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate? |
| A: InChIKey of methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate is OCZDPJJVPHISMJ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate? |
| A: Molecular formula of methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate is C12H14N4O2. |
| Q: What is the Chinese name of 76357-75-0? |
| A: Chinese name of 76357-75-0 is 76357-75-0. |
| Q: What is the molecular weight of methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate? |
| A: Molecular weight of methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate is 246.26500. |
| Q: What is the CAS number of methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate? |
| A: CAS number of methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate is 76357-75-0. |
| Q: What is the boiling point of methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate? |
| A: Boiling point of methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate is 333ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate? |
| A: Polar surface area (PSA) of methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate is 66.62000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |