methyl 5-dimethylamino-4-phenyl-triazole-4-carboxylate
Modify Date: 2025-09-26 18:25:35
methyl 5-dimethylamino-4-phenyl-triazole-4-carboxylate structure
|
Common Name | methyl 5-dimethylamino-4-phenyl-triazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 76357-75-0 | Molecular Weight | 246.26500 | |
| Density | 1.22g/cm3 | Boiling Point | 333ºC at 760 mmHg | |
| Molecular Formula | C12H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.2ºC | |
| Name | methyl 5-(dimethylamino)-4-phenyltriazole-4-carboxylate |
|---|
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 333ºC at 760 mmHg |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.26500 |
| Flash Point | 155.2ºC |
| Exact Mass | 246.11200 |
| PSA | 66.62000 |
| Index of Refraction | 1.595 |
| InChIKey | OCZDPJJVPHISMJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(c2ccccc2)N=NN=C1N(C)C |
|
~90%
methyl 5-dimeth... CAS#:76357-75-0 |
| Literature: Bernard, Christiane; Ghosez, Leon Journal of the Chemical Society, Chemical Communications, 1980 , # 20 p. 940 - 941 |
|
~%
methyl 5-dimeth... CAS#:76357-75-0 |
| Literature: Bernard, Christiane; Ghosez, Leon Journal of the Chemical Society, Chemical Communications, 1980 , # 20 p. 940 - 941 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |