Gabazine Ethyl Ester
Modify Date: 2024-01-16 23:46:58
Gabazine Ethyl Ester structure
|
Common Name | Gabazine Ethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 763886-63-1 | Molecular Weight | 315.36700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-[6-imino-3-(4-methoxyphenyl)pyridazin-1-yl]butanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H21N3O3 |
|---|---|
| Molecular Weight | 315.36700 |
| Exact Mass | 315.15800 |
| PSA | 77.20000 |
| LogP | 2.48120 |
| InChIKey | QEMMLRVUEGGDAH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCn1nc(-c2ccc(OC)cc2)ccc1=N |
|
~%
Gabazine Ethyl Ester CAS#:763886-63-1 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 20, # 19 p. 5957 - 5964 |
|
~%
Gabazine Ethyl Ester CAS#:763886-63-1 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 20, # 19 p. 5957 - 5964 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-aminopyridazine |
| Gabazine Ethyl Ester |