6,7-dihydroxy-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-one
Modify Date: 2024-04-05 19:19:15
6,7-dihydroxy-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-one structure
|
Common Name | 6,7-dihydroxy-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 76397-85-8 | Molecular Weight | 286.27900 | |
| Density | 1.37g/cm3 | Boiling Point | 555.9ºC at 760 mmHg | |
| Molecular Formula | C16H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.4ºC | |
| Name | 6,7-dihydroxy-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 555.9ºC at 760 mmHg |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.27900 |
| Flash Point | 212.4ºC |
| Exact Mass | 286.08400 |
| PSA | 75.99000 |
| LogP | 2.46530 |
| Index of Refraction | 1.637 |
| InChIKey | PZSNGTWDLWGBMP-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2COc3cc(O)c(O)cc3C2=O)cc1 |
| HS Code | 2932999099 |
|---|
|
~53%
6,7-dihydroxy-3... CAS#:76397-85-8 |
| Literature: Vasquez-Martinez, Yesseny; Ohri, Rachana V.; Kenyon, Victor; Holman, Theodore R.; Sepulveda-Boza, Silvia Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 23 p. 7408 - 7425 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6,7-Dihydroxy-4'-methoxyisoflavanone |