7-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)chroman-4-one structure
|
Common Name | 7-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)chroman-4-one | ||
|---|---|---|---|---|
| CAS Number | 76426-28-3 | Molecular Weight | 286.27900 | |
| Density | 1.37g/cm3 | Boiling Point | 546.7ºC at 760mmHg | |
| Molecular Formula | C16H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.6ºC | |
| Name | 7-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 546.7ºC at 760mmHg |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.27900 |
| Flash Point | 208.6ºC |
| Exact Mass | 286.08400 |
| PSA | 75.99000 |
| LogP | 2.81290 |
| Index of Refraction | 1.637 |
| InChIKey | WLRLGKUZHVJSQA-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2CC(=O)c3ccc(O)cc3O2)cc1O |
| Storage condition | 2-8°C |
|
~%
7-Hydroxy-2-(3-... CAS#:76426-28-3 |
| Literature: Rao; Seshadri Proceedings - Indian Academy of Sciences, Section A, 1941 , # 14 p. 29,34 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 7,3'-Dihydroxy-4'-methoxy-flavanon |