2,5-bis(1,1-dimethylbutyl)-4-methoxyphenol structure
|
Common Name | 2,5-bis(1,1-dimethylbutyl)-4-methoxyphenol | ||
|---|---|---|---|---|
| CAS Number | 76434-12-3 | Molecular Weight | 292.45600 | |
| Density | 0.939g/cm3 | Boiling Point | 397.7ºC at 760 mmHg | |
| Molecular Formula | C19H32O2 | Melting Point | 81ºC | |
| MSDS | N/A | Flash Point | 141.9ºC | |
| Name | 2,5-bis(1,1-dimethylbutyl)-4-methoxyphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.939g/cm3 |
|---|---|
| Boiling Point | 397.7ºC at 760 mmHg |
| Melting Point | 81ºC |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.45600 |
| Flash Point | 141.9ºC |
| Exact Mass | 292.24000 |
| PSA | 29.46000 |
| LogP | 5.55620 |
| Index of Refraction | 1.49 |
| InChIKey | MYGNMZZLRWDFID-UHFFFAOYSA-N |
| SMILES | CCCC(C)(C)c1cc(OC)c(C(C)(C)CCC)cc1O |
| HS Code | 2909500000 |
|---|
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Bisdimethylbutylmethoxyphenol |
| 2,4-DICHLORO-5-CYANOPYRIMIDINE |