Benzenepropanoic acid, alpha-fluoro-4-methyl-beta-oxo-, methyl ester (9CI) structure
|
Common Name | Benzenepropanoic acid, alpha-fluoro-4-methyl-beta-oxo-, methyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 76435-48-8 | Molecular Weight | 210.20200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-fluoro-3-(4-methylphenyl)-3-oxopropanoate |
|---|
| Molecular Formula | C11H11FO3 |
|---|---|
| Molecular Weight | 210.20200 |
| Exact Mass | 210.06900 |
| PSA | 43.37000 |
| LogP | 1.68880 |
| InChIKey | WTFRCVBMNVOYRT-UHFFFAOYSA-N |
| SMILES | COC(=O)C(F)C(=O)c1ccc(C)cc1 |
| HS Code | 2918300090 |
|---|
|
~%
Benzenepropanoi... CAS#:76435-48-8 |
| Literature: Ishikawa, Nobuo; Takaoka, Akio; Iwakiri, Hiroshi; Kubota, Satoshi; Kagaruki, S. R. F. Chemistry Letters, 1980 , p. 1107 - 1110 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |