3-Amino-2-methyl-1,1-diphenylpropan-2-ol
Modify Date: 2026-07-13 17:39:06
3-Amino-2-methyl-1,1-diphenylpropan-2-ol structure
|
Common Name | 3-Amino-2-methyl-1,1-diphenylpropan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 764597-32-2 | Molecular Weight | 241.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Amino-2-methyl-1,1-diphenylpropan-2-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H19NO |
|---|---|
| Molecular Weight | 241.33 |
| InChIKey | WEGIMRRECBCCBS-UHFFFAOYSA-N |
| SMILES | CC(O)(CN)C(c1ccccc1)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-Amino-2-methyl-1,1-diphenylpropan-2-ol? |
| A: InChIKey of 3-Amino-2-methyl-1,1-diphenylpropan-2-ol is WEGIMRRECBCCBS-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-Amino-2-methyl-1,1-diphenylpropan-2-ol? |
| A: CAS number of 3-Amino-2-methyl-1,1-diphenylpropan-2-ol is 764597-32-2. |
| Q: What is the Chinese name of 764597-32-2? |
| A: Chinese name of 764597-32-2 is 764597-32-2. |
| Q: What is the English name of 3-Amino-2-methyl-1,1-diphenylpropan-2-ol? |
| A: The English name of 3-Amino-2-methyl-1,1-diphenylpropan-2-ol is 3-Amino-2-methyl-1,1-diphenylpropan-2-ol. |
| Q: What is the molecular formula of 3-Amino-2-methyl-1,1-diphenylpropan-2-ol? |
| A: Molecular formula of 3-Amino-2-methyl-1,1-diphenylpropan-2-ol is C16H19NO. |
| Q: What is the molecular weight of 3-Amino-2-methyl-1,1-diphenylpropan-2-ol? |
| A: Molecular weight of 3-Amino-2-methyl-1,1-diphenylpropan-2-ol is 241.33. |
| Q: What is the SMILES notation of 3-Amino-2-methyl-1,1-diphenylpropan-2-ol? |
| A: SMILES notation of 3-Amino-2-methyl-1,1-diphenylpropan-2-ol is CC(O)(CN)C(c1ccccc1)c1ccccc1. |