2,4,6-tribromophenyl propionate
Modify Date: 2025-09-09 15:57:15
2,4,6-tribromophenyl propionate structure
|
Common Name | 2,4,6-tribromophenyl propionate | ||
|---|---|---|---|---|
| CAS Number | 76461-14-8 | Molecular Weight | 386.86300 | |
| Density | 2.013g/cm3 | Boiling Point | 361.1ºC at 760 mmHg | |
| Molecular Formula | C9H7Br3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.2ºC | |
| Name | (2,4,6-tribromophenyl) propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 2.013g/cm3 |
|---|---|
| Boiling Point | 361.1ºC at 760 mmHg |
| Molecular Formula | C9H7Br3O2 |
| Molecular Weight | 386.86300 |
| Flash Point | 172.2ºC |
| Exact Mass | 383.80000 |
| PSA | 26.30000 |
| LogP | 4.28950 |
| Index of Refraction | 1.595 |
| InChIKey | AYPLUWLTDGVVIR-UHFFFAOYSA-N |
| SMILES | CCC(=O)Oc1c(Br)cc(Br)cc1Br |
| HS Code | 2915509000 |
|---|
|
~%
2,4,6-tribromop... CAS#:76461-14-8 |
| Literature: Guareschi; Daccomo Chemische Berichte, 1885 , vol. 18, p. 1170 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915509000 |
|---|---|
| Summary | 2915509000 propionic acid, its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| EINECS 278-470-3 |
| 2,4,6-tribromophenyl propionate |
| Phenol,2,4,6-tribromo-,propanoate |
| 2,4,6-Tribromophenylpropionat |