3,6-Dichloro-2-methoxybenzoic acid mixt. with (2,4-dichlorophenoxy)acetic acid and O,O-bis(1-methylethyl) S-[2-[(phenylsulfonyl)amino]ethyl] phosphorodithioate structure
|
Common Name | 3,6-Dichloro-2-methoxybenzoic acid mixt. with (2,4-dichlorophenoxy)acetic acid and O,O-bis(1-methylethyl) S-[2-[(phenylsulfonyl)amino]ethyl] phosphorodithioate | ||
|---|---|---|---|---|
| CAS Number | 76462-67-4 | Molecular Weight | 839.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H36Cl4NO10PS3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,6-Dichloro-2-methoxybenzoic acid mixt. with (2,4-dichlorophenoxy)acetic acid and O,O-bis(1-methylethyl) S-[2-[(phenylsulfonyl)amino]ethyl] phosphorodithioate |
|---|
| Molecular Formula | C30H36Cl4NO10PS3 |
|---|---|
| Molecular Weight | 839.6 |
| InChIKey | CJKKBMGTPOUGQI-UHFFFAOYSA-N |
| SMILES | CC(C)OP(=S)(OC(C)C)SCCNS(=O)(=O)c1ccccc1.COc1c(Cl)ccc(Cl)c1C(=O)O.O=C(O)COc1ccc(Cl)cc1Cl |