3-(4,6-dimethyl-2-oxopyrimidin-1(2H)-yl)propanoic acid structure
|
Common Name | 3-(4,6-dimethyl-2-oxopyrimidin-1(2H)-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 764642-23-1 | Molecular Weight | 196.20300 | |
| Density | 1.26g/cm3 | Boiling Point | 366.1ºC at 760 mmHg | |
| Molecular Formula | C9H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.2ºC | |
| Name | 3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoic acid |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 366.1ºC at 760 mmHg |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.20300 |
| Flash Point | 175.2ºC |
| Exact Mass | 196.08500 |
| PSA | 72.19000 |
| LogP | 0.33480 |
| Index of Refraction | 1.569 |
| InChIKey | YABWUHTZYHYWMR-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)n(CCC(=O)O)c(=O)n1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |