5-(1-Hydroxy-2-(2,4,5-trifluorophenyl)ethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione structure
|
Common Name | 5-(1-Hydroxy-2-(2,4,5-trifluorophenyl)ethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione | ||
|---|---|---|---|---|
| CAS Number | 764667-64-3 | Molecular Weight | 316.229 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 489.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H11F3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.6±28.7 °C | |
| Name | 5-[1-hydroxy-2-(2,4,5-trifluorophenyl)ethylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 489.0±45.0 °C at 760 mmHg |
| Molecular Formula | C14H11F3O5 |
| Molecular Weight | 316.229 |
| Flash Point | 249.6±28.7 °C |
| Exact Mass | 316.055847 |
| PSA | 72.83000 |
| LogP | 1.01 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | COUGIGFQGFTRPG-UHFFFAOYSA-N |
| SMILES | CC1(C)OC(=O)C(=C(O)Cc2cc(F)c(F)cc2F)C(=O)O1 |
|
~95%
5-(1-Hydroxy-2-... CAS#:764667-64-3 |
| Literature: Ahn, Jin Hee; Shin, Mi Sik; Jun, Mi Ae; Jung, Sun Ho; Kang, Seung Kyu; Kim, Kwang Rok; Rhee, Sang Dal; Kang, Nam Sook; Kim, Sun Young; Sohn, Sang-Kwon; Kim, Sung Gyu; Jin, Mi Sun; Lee, Jie Oh; Cheon, Hyae Gyeong; Kim, Sung Soo Bioorganic and Medicinal Chemistry Letters, 2007 , vol. 17, # 9 p. 2622 - 2628 |
|
~%
5-(1-Hydroxy-2-... CAS#:764667-64-3 |
| Literature: WO2010/32264 A2, ; Page/Page column 25-26 ; |
|
~%
5-(1-Hydroxy-2-... CAS#:764667-64-3 |
| Literature: US2011/213149 A1, ; |
| 1,3-Dioxane-4,6-dione, 5-[1-hydroxy-2-(2,4,5-trifluorophenyl)ethylidene]-2,2-dimethyl- |
| 5-[1-hydroxy-2-(2,4,5-trifluorophenyl)ethylidine]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| 2,2-dimethyl-5-[(2,4,5-trifluorophenyl)acetyl]-1,3-dioxan-4,6-dione |
| 5-[1-Hydroxy-2-(2,4,5-trifluorophenyl)ethylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| 5-(1-hydroxy-2-(2,4,5-trifluorophenyl)ethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |