effusanin E structure
|
Common Name | effusanin E | ||
|---|---|---|---|---|
| CAS Number | 76470-15-0 | Molecular Weight | 364.43300 | |
| Density | 1.42±0.1 g/cm3 | Boiling Point | 591.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H28O6 | Melting Point | 240-242 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of effusanin EEffusanin E is a diterpenoid. Effusanin E, a 7α, 20-Epoxy-ent-kauranoid, can be obtained from Isodon parvifolius. Effusanin E can be used for the research of cancer[1]. |
| Name | effusanin E |
|---|---|
| Synonym | More Synonyms |
| Description | Effusanin E is a diterpenoid. Effusanin E, a 7α, 20-Epoxy-ent-kauranoid, can be obtained from Isodon parvifolius. Effusanin E can be used for the research of cancer[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.42±0.1 g/cm3 |
|---|---|
| Boiling Point | 591.3±50.0 °C at 760 mmHg |
| Melting Point | 240-242 °C |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.43300 |
| Exact Mass | 364.18900 |
| PSA | 107.22000 |
| LogP | 0.37560 |
| InChIKey | HLVWYILWVYNUAJ-CJTLNYFMSA-N |
| SMILES | C=C1C(=O)C23CC1CC(O)C2C12COC3(O)C(O)C1C(C)(C)CCC2O |
| effusanin |
| Effusanin E |