loracarbef structure
|
Common Name | loracarbef | ||
|---|---|---|---|---|
| CAS Number | 76470-66-1 | Molecular Weight | 349.76900 | |
| Density | 1.52g/cm3 | Boiling Point | 662.2ºC at 760 mmHg | |
| Molecular Formula | C16H16ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 354.3ºC | |
Use of loracarbefLoracarbef (Lorabid), a cephalosporin antibiotic, is an orally active second-generation synthetic beta-lactam antibiotic of the carbacephem class[1][2]. |
| Name | loracarbef |
|---|---|
| Synonym | More Synonyms |
| Description | Loracarbef (Lorabid), a cephalosporin antibiotic, is an orally active second-generation synthetic beta-lactam antibiotic of the carbacephem class[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Loracarbef (Lorabid) demonstrates excellent activity against isolates of Escherichia coli and Klebsiella, Proteus and Salmonella species[2]. |
| References |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 662.2ºC at 760 mmHg |
| Molecular Formula | C16H16ClN3O4 |
| Molecular Weight | 349.76900 |
| Flash Point | 354.3ºC |
| Exact Mass | 349.08300 |
| PSA | 112.73000 |
| LogP | 1.73990 |
| Index of Refraction | 1.677 |
| InChIKey | JAPHQRWPEGVNBT-UTUOFQBUSA-N |
| SMILES | NC(C(=O)NC1C(=O)N2C(C(=O)O)=C(Cl)CCC12)c1ccccc1 |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| (6R,7S)-1,3,10-bisabolatriene |
| 5-(1,5-dimethyl-4-hexenyl)-2-methyl-1,3-cyclohexadiene |
| (-)-(4S,7S)-zingiberene |
| (6R,7S)-7-[(R)-2-amino-2-phenylacetamido]-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-carboxylic acid |
| (6R,7S)-zingiberene |
| (6R,7S)-7-((R)-2-amino-2-phenylacetamido)-3-chloro-8-oxo-1-aza-bicyclo[4.2.0]oct-2-ene-2-carboxylic acid |