4-Methoxyphenyl 4-(3-Butenyloxy)benzoate
Modify Date: 2025-08-23 19:58:28
4-Methoxyphenyl 4-(3-Butenyloxy)benzoate structure
|
Common Name | 4-Methoxyphenyl 4-(3-Butenyloxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 76487-56-4 | Molecular Weight | 298.33300 | |
| Density | 1.123g/cm3 | Boiling Point | 445.2ºC at 760 mmHg | |
| Molecular Formula | C18H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.4ºC | |
| Name | 4-Methoxyphenyl 4-(3-Butenyloxy)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.123g/cm3 |
|---|---|
| Boiling Point | 445.2ºC at 760 mmHg |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.33300 |
| Flash Point | 196.4ºC |
| Exact Mass | 298.12100 |
| PSA | 44.76000 |
| LogP | 3.86930 |
| Index of Refraction | 1.552 |
| InChIKey | CXPLNUIZUUBDCU-UHFFFAOYSA-N |
| SMILES | C=CCCOc1ccc(C(=O)Oc2ccc(OC)cc2)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (4-methoxyphenyl) 4-but-3-enoxybenzoate |