ethyl N-methyl-N-(4-methyl-5-oxo-1-pyridin-2-yl-1,2,4-triazol-3-yl)carbamate structure
|
Common Name | ethyl N-methyl-N-(4-methyl-5-oxo-1-pyridin-2-yl-1,2,4-triazol-3-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 76496-24-7 | Molecular Weight | 277.27900 | |
| Density | 1.32g/cm3 | Boiling Point | 368.7ºC at 760 mmHg | |
| Molecular Formula | C12H15N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.8ºC | |
| Name | ethyl N-methyl-N-(4-methyl-5-oxo-1-pyridin-2-yl-1,2,4-triazol-3-yl)carbamate |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 368.7ºC at 760 mmHg |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.27900 |
| Flash Point | 176.8ºC |
| Exact Mass | 277.11700 |
| PSA | 82.25000 |
| LogP | 0.55870 |
| Index of Refraction | 1.618 |
| InChIKey | FBLWPYWIODGHRQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N(C)c1nn(-c2ccccn2)c(=O)n1C |
|
~%
ethyl N-methyl-... CAS#:76496-24-7 |
| Literature: Venkataratnam, R. V.; Mohan, K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 9 p. 805 - 809 |
|
~%
ethyl N-methyl-... CAS#:76496-24-7 |
| Literature: Venkataratnam, R. V.; Mohan, K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 9 p. 805 - 809 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |