Ethanone,2-diazo-1-(3,3-dimethyl-2-phenyl-2-oxiranyl)
Ethanone,2-diazo-1-(3,3-dimethyl-2-phenyl-2-oxiranyl) structure
|
Common Name | Ethanone,2-diazo-1-(3,3-dimethyl-2-phenyl-2-oxiranyl) | ||
|---|---|---|---|---|
| CAS Number | 76504-49-9 | Molecular Weight | 216.23600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate, also known as Ethanone,2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl), with CAS number 76504-49-9, molecular formula C12H12N2O2, and molecular weight 216.23600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12N2O2 |
|---|---|
| Molecular Weight | 216.23600 |
| Exact Mass | 216.09000 |
| PSA | 66.99000 |
| LogP | 1.64146 |
| InChIKey | AQKKPKBPKDHCHF-UHFFFAOYSA-N |
| SMILES | CC1(C)OC1(C(=O)C=[N+]=[N-])c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Ethanone,2-diaz... CAS#:76504-49-9 |
| Literature: Thijs, L.; Smeets, F. L. M.; Cillissen, P. J. M.; Harmsen, J.; Zwanenburg, B. Tetrahedron, 1980 , vol. 36, # 88 p. 2141 - 2144 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate? |
| A: Molecular weight of (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate is 216.23600. |
| Q: What is the English name of (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate? |
| A: The English name of (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate is (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate. |
| Q: What is the SMILES notation of (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate? |
| A: SMILES notation of (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate is CC1(C)OC1(C(=O)C=[N+]=[N-])c1ccccc1. |
| Q: What are the upstream materials of (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate? |
| A: Related upstream materials(CAS) of (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate: 24568-18-1. |
| Q: What is the molecular formula of (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate? |
| A: Molecular formula of (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate is C12H12N2O2. |
| Q: What is the Chinese name of 76504-49-9? |
| A: Chinese name of 76504-49-9 is 76504-49-9. |
| Q: What is the LogP of (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate? |
| A: LogP of (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate is 1.64146. |
| Q: What is the CAS number of (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate? |
| A: CAS number of (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate is 76504-49-9. |
| Q: What is the InChIKey of (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate? |
| A: InChIKey of (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate is AQKKPKBPKDHCHF-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate? |
| A: Polar surface area (PSA) of (Z)-2-diazonio-1-(3,3-dimethyl-2-phenyloxiran-2-yl)ethenolate is 66.99000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |