methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate
methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate structure
|
Common Name | methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 76527-29-2 | Molecular Weight | 206.23800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14O3 |
|---|---|
| Molecular Weight | 206.23800 |
| Exact Mass | 206.09400 |
| PSA | 38.83000 |
| LogP | 1.86370 |
| InChIKey | LVMYNDJSYMWEGM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(c2ccccc2)OC1(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Oxiranecarboxylic acid,3,3-dimethyl-2-phenyl-,methyl ester |
| Methyl 2,2-dimethyl-3-phenyl-3-oxiranecarboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate? |
| A: Molecular weight of methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate is 206.23800. |
| Q: What are the upstream materials of methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate? |
| A: Related upstream materials(CAS) of methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate: 611-70-1;5445-32-9;67-64-1;33131-36-1;15206-55-0. |
| Q: What is the polar surface area (PSA) of methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate? |
| A: Polar surface area (PSA) of methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate is 38.83000. |
| Q: What is the InChIKey of methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate? |
| A: InChIKey of methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate is LVMYNDJSYMWEGM-UHFFFAOYSA-N. |
| Q: What is the molecular formula of methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate? |
| A: Molecular formula of methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate is C12H14O3. |
| Q: What is the English name of methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate? |
| A: The English name of methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate is methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate. |
| Q: What is the SMILES notation of methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate? |
| A: SMILES notation of methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate is COC(=O)C1(c2ccccc2)OC1(C)C. |
| Q: What is the Chinese name of 76527-29-2? |
| A: Chinese name of 76527-29-2 is 76527-29-2. |
| Q: What is the CAS number of methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate? |
| A: CAS number of methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate is 76527-29-2. |
| Q: What English synonyms does methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate have? |
| A: English synonyms of methyl 3,3-dimethyl-2-phenyloxirane-2-carboxylate: Oxiranecarboxylic acid,3,3-dimethyl-2-phenyl-,methyl ester, Methyl 2,2-dimethyl-3-phenyl-3-oxiranecarboxylate. |