1,3,5,2,4,6-Triazatriphosphorine,2,2-bis(butylthio)-4,4,6,6-tetrachloro-2,2,4,4,6,6-hexahydro- (7CI,8CI) structure
|
Common Name | 1,3,5,2,4,6-Triazatriphosphorine,2,2-bis(butylthio)-4,4,6,6-tetrachloro-2,2,4,4,6,6-hexahydro- (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 7653-11-4 | Molecular Weight | 455.11200 | |
| Density | 1.66g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H18Cl4N3P3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-bis(butylsulfanyl)-4,4,6,6-tetrachloro-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.66g/cm3 |
|---|---|
| Molecular Formula | C8H18Cl4N3P3S2 |
| Molecular Weight | 455.11200 |
| Exact Mass | 452.89100 |
| PSA | 117.11000 |
| LogP | 8.16720 |
| Index of Refraction | 1.655 |
| InChIKey | VHQFAFBONZQQKU-UHFFFAOYSA-N |
| SMILES | CCCCSP1(SCCCC)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1 |
|
~%
1,3,5,2,4,6-Tri... CAS#:7653-11-4 |
| Literature: Carroll,A.P.; Shaw,R.A. Journal of the Chemical Society [Section] A: Inorganic, Physical, Theoretical, 1966 , p. 914 - 921 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,2,4,4-Tetrachlor-6,6-bis-n-butylthio-cyclotriphosphazatrien |
| 2,2-bis(butylsulfanyl)-4,4,6,6-tetrachloro-1,3,5-triaza-2 |