N-[4-(2,4-dichlorophenoxy)phenyl]hydroxylamine structure
|
Common Name | N-[4-(2,4-dichlorophenoxy)phenyl]hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 76532-45-1 | Molecular Weight | 270.11100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-(2,4-dichlorophenoxy)phenyl]hydroxylamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H9Cl2NO2 |
|---|---|
| Molecular Weight | 270.11100 |
| Exact Mass | 269.00100 |
| PSA | 41.49000 |
| LogP | 4.65980 |
| InChIKey | BUJCMVKZULBFON-UHFFFAOYSA-N |
| SMILES | ONc1ccc(Oc2ccc(Cl)cc2Cl)cc1 |
|
~41%
N-[4-(2,4-dichl... CAS#:76532-45-1 |
| Literature: Yoshioka, Tadao; Yamada, Hidetoshi; Uematsu, Takayoshi Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 1271 - 1276 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| ether,2,4-dinitrophenyl 4-hydroxylaminophenyl |