3-[[3,4-dihydroxy-5-(6-oxo-3H-purin-9-yl)oxolan-2-yl]methyl]-1-methyl-1-nitroso-urea structure
|
Common Name | 3-[[3,4-dihydroxy-5-(6-oxo-3H-purin-9-yl)oxolan-2-yl]methyl]-1-methyl-1-nitroso-urea | ||
|---|---|---|---|---|
| CAS Number | 76563-05-8 | Molecular Weight | 353.29100 | |
| Density | 1.99g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H15N7O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[[3,4-dihydroxy-5-(6-oxo-3H-purin-9-yl)oxolan-2-yl]methyl]-1-methyl-1-nitrosourea |
|---|
| Density | 1.99g/cm3 |
|---|---|
| Molecular Formula | C12H15N7O6 |
| Molecular Weight | 353.29100 |
| Exact Mass | 353.10800 |
| PSA | 175.03000 |
| Index of Refraction | 1.843 |
| InChIKey | LLXKHIASUDTHFG-UHFFFAOYSA-N |
| SMILES | CN(N=O)C(=O)NCC1OC(n2cnc3c(=O)[nH]cnc32)C(O)C1O |
|
~35%
3-[[3,4-dihydro... CAS#:76563-05-8 |
| Literature: Elliott, Robert D.; Brockman, R. Wallace; Montgomery, John A. Journal of Medicinal Chemistry, 1981 , vol. 24, # 3 p. 350 - 352 |
|
~%
3-[[3,4-dihydro... CAS#:76563-05-8 |
| Literature: Elliott, Robert D.; Brockman, R. Wallace; Montgomery, John A. Journal of Medicinal Chemistry, 1981 , vol. 24, # 3 p. 350 - 352 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |