2,4-Dimethoxybenzoylacetonitrile structure
|
Common Name | 2,4-Dimethoxybenzoylacetonitrile | ||
|---|---|---|---|---|
| CAS Number | 76569-43-2 | Molecular Weight | 205.21000 | |
| Density | 1.147g/cm3 | Boiling Point | 401.9ºC at 760 mmHg | |
| Molecular Formula | C11H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.8ºC | |
| Name | 3-(2,4-dimethoxyphenyl)-3-oxopropanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.147g/cm3 |
|---|---|
| Boiling Point | 401.9ºC at 760 mmHg |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21000 |
| Flash Point | 175.8ºC |
| Exact Mass | 205.07400 |
| PSA | 59.32000 |
| LogP | 1.80018 |
| Index of Refraction | 1.517 |
| InChIKey | ZLENRTUQTZZRDG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CC#N)c(OC)c1 |
| HS Code | 2926909090 |
|---|
|
~%
2,4-Dimethoxybe... CAS#:76569-43-2 |
| Literature: Journal of the American Chemical Society, , vol. 69, p. 990,993 US2392167 , ; |
|
~%
2,4-Dimethoxybe... CAS#:76569-43-2 |
| Literature: Chemische Berichte, , vol. 51, p. 1831 |
|
~%
2,4-Dimethoxybe... CAS#:76569-43-2 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 2894 - 2900 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,4,9-TRIAZATRICYCLO[3.3.1.1~3,7~]DECAN-7-AMINE |
| (2.4-Dimethoxy-benzoyl)-essigsaeurenitril |
| 3-(2,4-dimethoxy-phenyl)-3-oxo-propionitrile |
| 2,4-dimethoxbenzoylacetonitrile |
| 2,4-Dimethoxybenzoylacetonitrile |
| 3-Oxo-3-(2.4-dimethoxy-phenyl)-propionsaeure-nitril |
| 2,4-dimethoxycyanoacetophenone |
| 3-(2,4-Dimethoxy-phenyl)-3-oxo-propionitril |