(2,4,5-trichlorophenyl) 4-(hydroxymethyl)benzoate structure
|
Common Name | (2,4,5-trichlorophenyl) 4-(hydroxymethyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 76571-67-0 | Molecular Weight | 331.57800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9Cl3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,4,5-trichlorophenyl) 4-(hydroxymethyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H9Cl3O3 |
|---|---|
| Molecular Weight | 331.57800 |
| Exact Mass | 329.96200 |
| PSA | 46.53000 |
| LogP | 4.35830 |
| InChIKey | ULSMLVTWENTBDU-UHFFFAOYSA-N |
| SMILES | O=C(Oc1cc(Cl)c(Cl)cc1Cl)c1ccc(CO)cc1 |
|
~86%
(2,4,5-trichlor... CAS#:76571-67-0 |
| Literature: Atherton, Eric; Logan, Christopher J.; Sheppard, Robert C. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 538 - 546 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| p-hydroxymethylbenzoic acid 2,4,5-trichlorophenyl ester |