4-naphthalen-2-ylbut-1-ynoxy-tri(propan-2-yl)silane structure
|
Common Name | 4-naphthalen-2-ylbut-1-ynoxy-tri(propan-2-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 765906-54-5 | Molecular Weight | 352.58500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H32OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-naphthalen-2-ylbut-1-ynoxy-tri(propan-2-yl)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H32OSi |
|---|---|
| Molecular Weight | 352.58500 |
| Exact Mass | 352.22200 |
| PSA | 9.23000 |
| LogP | 6.92540 |
| InChIKey | JVNACFAODBIELD-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](OC#CCCc1ccc2ccccc2c1)(C(C)C)C(C)C |
|
~93%
4-naphthalen-2-... CAS#:765906-54-5 |
| Literature: Zhang, Liming; Sun, Jianwei; Kozmin, Sergey A. Tetrahedron, 2006 , vol. 62, # 49 p. 11371 - 11380 |
|
~%
4-naphthalen-2-... CAS#:765906-54-5 |
| Literature: Zhang, Liming; Kozmin, Sergey A. Journal of the American Chemical Society, 2004 , vol. 126, # 33 p. 10204 - 10205 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Silane,tris(1-methylethyl)[[4-(2-naphthalenyl)-1-butynyl]oxy] |