2-(3,4-dichlorophenyl)-5-methylpyrazol-3-amine structure
|
Common Name | 2-(3,4-dichlorophenyl)-5-methylpyrazol-3-amine | ||
|---|---|---|---|---|
| CAS Number | 76606-68-3 | Molecular Weight | 242.10500 | |
| Density | 1.45g/cm3 | Boiling Point | 396.5ºC at 760 mmHg | |
| Molecular Formula | C10H9Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.6ºC | |
| Name | 2-(3,4-dichlorophenyl)-5-methylpyrazol-3-amine |
|---|
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 396.5ºC at 760 mmHg |
| Molecular Formula | C10H9Cl2N3 |
| Molecular Weight | 242.10500 |
| Flash Point | 193.6ºC |
| Exact Mass | 241.01700 |
| PSA | 43.84000 |
| LogP | 3.65090 |
| Index of Refraction | 1.659 |
| InChIKey | GZPXDQVNWLLCBG-UHFFFAOYSA-N |
| SMILES | Cc1cc(N)n(-c2ccc(Cl)c(Cl)c2)n1 |
| HS Code | 2933199090 |
|---|
|
~81%
2-(3,4-dichloro... CAS#:76606-68-3 |
| Literature: Ferroni; Milani; Simoni; Orlandini; Poli; Guarneri Farmaco, Edizione Scientifica, 1988 , vol. 43, # 11 p. 891 - 899 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |