3-[2-(1H-benzimidazol-2-yl)phenyl]-6-iodo-2-phenylquinazolin-4-one structure
|
Common Name | 3-[2-(1H-benzimidazol-2-yl)phenyl]-6-iodo-2-phenylquinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 76618-05-8 | Molecular Weight | 540.35500 | |
| Density | 1.61g/cm3 | Boiling Point | 728.8ºC at 760 mmHg | |
| Molecular Formula | C27H17IN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 394.6ºC | |
| Name | 3-[2-(1H-benzimidazol-2-yl)phenyl]-6-iodo-2-phenylquinazolin-4-one |
|---|
| Density | 1.61g/cm3 |
|---|---|
| Boiling Point | 728.8ºC at 760 mmHg |
| Molecular Formula | C27H17IN4O |
| Molecular Weight | 540.35500 |
| Flash Point | 394.6ºC |
| Exact Mass | 540.04500 |
| PSA | 63.57000 |
| LogP | 6.20060 |
| Index of Refraction | 1.761 |
| InChIKey | RVOALXWXDRKAPQ-UHFFFAOYSA-N |
| SMILES | O=c1c2cc(I)ccc2nc(-c2ccccc2)n1-c1ccccc1-c1nc2ccccc2[nH]1 |
|
~%
3-[2-(1H-benzim... CAS#:76618-05-8 |
| Literature: Kulkarni; Kumar; Abdi Journal of the Indian Chemical Society, 1983 , vol. 60, # 9 p. 906 - 907 |
|
~%
3-[2-(1H-benzim... CAS#:76618-05-8 |
| Literature: Kulkarni; Kumar; Abdi Journal of the Indian Chemical Society, 1983 , vol. 60, # 9 p. 906 - 907 |
|
~%
3-[2-(1H-benzim... CAS#:76618-05-8 |
| Literature: Misra; Gupta; Pandey; Nath Die Pharmazie, 1980 , vol. 35, # 7 p. 400 - 401 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |