carbizocaine structure
|
Common Name | carbizocaine | ||
|---|---|---|---|---|
| CAS Number | 76629-87-3 | Molecular Weight | 364.52200 | |
| Density | 1.016g/cm3 | Boiling Point | 434.7ºC at 760 mmHg | |
| Molecular Formula | C21H36N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.7ºC | |
| Name | 1-(diethylamino)propan-2-yl N-(2-heptoxyphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.016g/cm3 |
|---|---|
| Boiling Point | 434.7ºC at 760 mmHg |
| Molecular Formula | C21H36N2O3 |
| Molecular Weight | 364.52200 |
| Flash Point | 216.7ºC |
| Exact Mass | 364.27300 |
| PSA | 54.29000 |
| LogP | 5.32820 |
| Index of Refraction | 1.515 |
| InChIKey | PYSAVFUPLJMDHW-UHFFFAOYSA-N |
| SMILES | CCCCCCCOc1ccccc1NC(=O)OC(C)CN(CC)CC |
| HS Code | 2924299090 |
|---|
|
~%
carbizocaine CAS#:76629-87-3 |
| Literature: Stankovicova; Stolc; Csollei; Benes Pharmazie, 1995 , vol. 50, # 9 p. 622 - 623 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Carbizocaine |
| carbisocaine |
| Carbamic acid,(2-(heptyloxy)phenyl)-,2-(diethylamino)-1-methyethyl ester |
| 2-(Diethylamino)-1-methyethyl (2-(heptyloxy)phenyl)carbamate |
| 1-diethylaminopropan-2-yl N-(2-heptoxyphenyl)carbamate |