N-Formyl-L-phenylalanine 4-nitrophenyl ester
Modify Date: 2026-08-03 12:26:38
N-Formyl-L-phenylalanine 4-nitrophenyl ester structure
|
Common Name | N-Formyl-L-phenylalanine 4-nitrophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 7663-83-4 | Molecular Weight | 314.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-Formyl-L-phenylalanine 4-nitrophenyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H14N2O5 |
|---|---|
| Molecular Weight | 314.29 |
| InChIKey | WEKDQGWXYNRAAW-HNNXBMFYSA-N |
| SMILES | O=CNC(Cc1ccccc1)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-Formyl-L-phenylalanine 4-nitrophenyl ester? |
| A: SMILES notation of N-Formyl-L-phenylalanine 4-nitrophenyl ester is O=CNC(Cc1ccccc1)C(=O)Oc1ccc([N+](=O)[O-])cc1. |
| Q: What is the molecular formula of N-Formyl-L-phenylalanine 4-nitrophenyl ester? |
| A: Molecular formula of N-Formyl-L-phenylalanine 4-nitrophenyl ester is C16H14N2O5. |
| Q: What is the English name of N-Formyl-L-phenylalanine 4-nitrophenyl ester? |
| A: The English name of N-Formyl-L-phenylalanine 4-nitrophenyl ester is N-Formyl-L-phenylalanine 4-nitrophenyl ester. |
| Q: What is the molecular weight of N-Formyl-L-phenylalanine 4-nitrophenyl ester? |
| A: Molecular weight of N-Formyl-L-phenylalanine 4-nitrophenyl ester is 314.29. |
| Q: What is the Chinese name of 7663-83-4? |
| A: Chinese name of 7663-83-4 is 7663-83-4. |
| Q: What is the InChIKey of N-Formyl-L-phenylalanine 4-nitrophenyl ester? |
| A: InChIKey of N-Formyl-L-phenylalanine 4-nitrophenyl ester is WEKDQGWXYNRAAW-HNNXBMFYSA-N. |
| Q: What is the CAS number of N-Formyl-L-phenylalanine 4-nitrophenyl ester? |
| A: CAS number of N-Formyl-L-phenylalanine 4-nitrophenyl ester is 7663-83-4. |