5-Amino-3-(3-fluorophenyl)pyrazole
Modify Date: 2026-07-01 19:24:48
5-Amino-3-(3-fluorophenyl)pyrazole structure
|
Common Name | 5-Amino-3-(3-fluorophenyl)pyrazole | ||
|---|---|---|---|---|
| CAS Number | 766519-89-5 | Molecular Weight | 177.17800 | |
| Density | 1.334g/cm3 | Boiling Point | 441.2ºC at 760 mmHg | |
| Molecular Formula | C9H8FN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.7ºC | |
| Name | 5-(3-fluoro-phenyl)-2h-pyrazol-3-ylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.334g/cm3 |
|---|---|
| Boiling Point | 441.2ºC at 760 mmHg |
| Molecular Formula | C9H8FN3 |
| Molecular Weight | 177.17800 |
| Flash Point | 220.7ºC |
| Exact Mass | 177.07000 |
| PSA | 54.70000 |
| LogP | 2.37920 |
| Index of Refraction | 1.636 |
| InChIKey | JWISUMPCIIZLHQ-UHFFFAOYSA-N |
| SMILES | Nc1cc(-c2cccc(F)c2)[nH]n1 |
| HS Code | 2933199090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(3-fluorophenyl)-1H-pyrazol-5-amine |
| 3-Amino-5-(3-fluorophenyl)-1H-pyrazole |