AKOS B013924
Modify Date: 2025-08-25 18:16:24
AKOS B013924 structure
|
Common Name | AKOS B013924 | ||
|---|---|---|---|---|
| CAS Number | 76674-31-2 | Molecular Weight | 208.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3,5-Dimethylphenoxy)-2-methylpropanoic acid |
|---|
| Molecular Formula | C12H16O3 |
|---|---|
| Molecular Weight | 208.25400 |
| Exact Mass | 208.11000 |
| PSA | 46.53000 |
| LogP | 2.54540 |
| InChIKey | SXWGTMNDGSAUON-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(OC(C)(C)C(=O)O)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |