1H-1,2,4-Triazole-1-ethanol, beta-((4-chlorophenyl)methylene)-alpha-(1 ,1-dimethylethyl)-, (Z)- structure
|
Common Name | 1H-1,2,4-Triazole-1-ethanol, beta-((4-chlorophenyl)methylene)-alpha-(1 ,1-dimethylethyl)-, (Z)- | ||
|---|---|---|---|---|
| CAS Number | 76713-90-1 | Molecular Weight | 291.77600 | |
| Density | 1.18g/cm3 | Boiling Point | 474.6ºC at 760 mmHg | |
| Molecular Formula | C15H18ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.8ºC | |
| Name | (Z)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 474.6ºC at 760 mmHg |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.77600 |
| Flash Point | 240.8ºC |
| Exact Mass | 291.11400 |
| PSA | 50.94000 |
| LogP | 3.33660 |
| Index of Refraction | 1.579 |
| InChIKey | YNWVFADWVLCOPU-JYRVWZFOSA-N |
| SMILES | CC(C)(C)C(O)C(=Cc1ccc(Cl)cc1)n1cncn1 |
| HS Code | 2933990090 |
|---|
|
~%
1H-1,2,4-Triazo... CAS#:76713-90-1 |
| Literature: Sumitomo Chemical Company, Limited Patent: US4749809 A1, 1988 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Sumagic |
| Prunit |
| Majic S 3307D |
| Sumiseven |
| Pentefenzol |
| Majic |