2-Phenylquinazoline-4-carboxylic acid structure
|
Common Name | 2-Phenylquinazoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 7672-01-7 | Molecular Weight | 250.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-phenyl-4-quinazolinecarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H10N2O2 |
|---|---|
| Molecular Weight | 250.25200 |
| Exact Mass | 250.07400 |
| PSA | 63.08000 |
| LogP | 2.99500 |
| InChIKey | JSVHXYUJLYICKV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1nc(-c2ccccc2)nc2ccccc12 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2-phenyl-quinazoline-4-carboxylic acid |
| 2-phenylquinazoline-4-carboxylic acid |
| 2-Phenylquinazoline-4-carboxylic acid |
| 2-Phenyl-chinazolin-4-carbonsaeure |