N-[3-(diethylamino)phenyl]butyramide structure
|
Common Name | N-[3-(diethylamino)phenyl]butyramide | ||
|---|---|---|---|---|
| CAS Number | 76751-08-1 | Molecular Weight | 234.33700 | |
| Density | 1.034g/cm3 | Boiling Point | 409.3ºC at 760 mmHg | |
| Molecular Formula | C14H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.3ºC | |
| Name | N-[3-(diethylamino)phenyl]butanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.034g/cm3 |
|---|---|
| Boiling Point | 409.3ºC at 760 mmHg |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.33700 |
| Flash Point | 201.3ºC |
| Exact Mass | 234.17300 |
| PSA | 35.83000 |
| LogP | 3.92090 |
| Index of Refraction | 1.561 |
| InChIKey | CZGBOOOASWOIKL-UHFFFAOYSA-N |
| SMILES | CCCC(=O)Nc1cccc(N(CC)CC)c1 |
| HS Code | 2924299090 |
|---|
|
~%
N-[3-(diethylam... CAS#:76751-08-1 |
| Literature: Thiel, W.; Mayer, R.; Jauer, E.-A.; Modrow, H.; Dost, H. Journal fuer Praktische Chemie (Leipzig), 1986 , vol. 328, # 4 p. 497 - 514 |
|
~%
N-[3-(diethylam... CAS#:76751-08-1 |
| Literature: Thiel, W.; Mayer, R.; Jauer, E.-A.; Modrow, H.; Dost, H. Journal fuer Praktische Chemie (Leipzig), 1986 , vol. 328, # 4 p. 497 - 514 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Butyramido-N,N-diethyl-anilin |
| EINECS 278-540-3 |