3-tert-butyl-10H-phenothiazine structure
|
Common Name | 3-tert-butyl-10H-phenothiazine | ||
|---|---|---|---|---|
| CAS Number | 7678-79-7 | Molecular Weight | 255.37800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-tert-butyl-10H-phenothiazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H17NS |
|---|---|
| Molecular Weight | 255.37800 |
| Exact Mass | 255.10800 |
| PSA | 37.33000 |
| LogP | 5.33030 |
| InChIKey | PAWLMNZZDMBOOL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc2c(c1)Sc1ccccc1N2 |
|
~%
3-tert-butyl-10... CAS#:7678-79-7 |
| Literature: Cadogan,J.I.G. et al. Journal of the Chemical Society [Section] C: Organic, 1970 , p. 2437 - 2441 |
|
~%
3-tert-butyl-10... CAS#:7678-79-7 |
| Literature: Cadogan,J.I.G. et al. Journal of the Chemical Society [Section] C: Organic, 1970 , p. 2437 - 2441 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3-tert.-Butyl-phenothiazin |
| 3-t-Butylphenothiazin |