methyl 2,4,6-trioxo-6-phenylhexanoate structure
|
Common Name | methyl 2,4,6-trioxo-6-phenylhexanoate | ||
|---|---|---|---|---|
| CAS Number | 76798-27-1 | Molecular Weight | 248.23100 | |
| Density | 1.233g/cm3 | Boiling Point | 372.5ºC at 760 mmHg | |
| Molecular Formula | C13H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.2ºC | |
| Name | methyl 2,4,6-trioxo-6-phenylhexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 372.5ºC at 760 mmHg |
| Molecular Formula | C13H12O5 |
| Molecular Weight | 248.23100 |
| Flash Point | 165.2ºC |
| Exact Mass | 248.06800 |
| PSA | 77.51000 |
| LogP | 0.96070 |
| Index of Refraction | 1.521 |
| InChIKey | UHBQYIPCSNKCFU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)CC(=O)c1ccccc1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 278-552-9 |
| Methyl 6-phenyl-2,4,6-trioxohexanoate |