2,2-dimethyl-6-prop-2-enoxy-3H-1,3-benzoxazin-4-one structure
|
Common Name | 2,2-dimethyl-6-prop-2-enoxy-3H-1,3-benzoxazin-4-one | ||
|---|---|---|---|---|
| CAS Number | 76813-99-5 | Molecular Weight | 233.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-dimethyl-6-prop-2-enoxy-3H-1,3-benzoxazin-4-one |
|---|
| Molecular Formula | C13H15NO3 |
|---|---|
| Molecular Weight | 233.26300 |
| Exact Mass | 233.10500 |
| PSA | 51.05000 |
| LogP | 2.12010 |
| InChIKey | PRCAMCFGDYDJOB-UHFFFAOYSA-N |
| SMILES | C=CCOc1ccc2c(c1)C(=O)NC(C)(C)O2 |
|
~92%
2,2-dimethyl-6-... CAS#:76813-99-5 |
| Literature: Fuhrer; Ostermayer; Zimmermann; Meier; Mueller Journal of Medicinal Chemistry, 1984 , vol. 27, # 7 p. 831 - 836 |
|
~%
2,2-dimethyl-6-... CAS#:76813-99-5 |
| Literature: Fuhrer; Ostermayer; Zimmermann; Meier; Mueller Journal of Medicinal Chemistry, 1984 , vol. 27, # 7 p. 831 - 836 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |