3-ethoxy-3-oxo-2-(phenylmethoxycarbonylamino)propanoate structure
|
Common Name | 3-ethoxy-3-oxo-2-(phenylmethoxycarbonylamino)propanoate | ||
|---|---|---|---|---|
| CAS Number | 7682-49-7 | Molecular Weight | 280.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14NO6- | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-ethoxy-3-oxo-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H14NO6- |
|---|---|
| Molecular Weight | 280.25300 |
| Exact Mass | 280.08200 |
| PSA | 108.25000 |
| InChIKey | FIRCAPNAXXIWRP-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C(NC(=O)OCc1ccccc1)C(=O)[O-] |
|
~77%
3-ethoxy-3-oxo-... CAS#:7682-49-7 |
| Literature: Wheelan, Pat; Kirsch, Wolff M.; Koch, Tad H. Journal of Organic Chemistry, 1989 , vol. 54, # 6 p. 1364 - 1370 |
|
~%
3-ethoxy-3-oxo-... CAS#:7682-49-7 |
| Literature: Schneider Biochemische Zeitschrift, 1937 , vol. 291, p. 328,338 |
|
~%
3-ethoxy-3-oxo-... CAS#:7682-49-7 |
| Literature: Fujino; Wakimasu; Mano; Tanaka; Nakajima Chemical and Pharmaceutical Bulletin, 1976 , vol. 24, # 9 p. 2112 - 2117 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-benzyloxycarbonylaminomalonic acid monoethyl ester |
| Benzyloxycarbonylamino-malonsaeure-monoaethylester |
| benzyloxycarbonylamino-malonic acid monoethyl ester |
| Monoethyl N-benzyloxycarbonyl-2-aminomalonate |