2-(3,5-dichlorophenoxy)aniline
Modify Date: 2026-07-06 13:05:33
2-(3,5-dichlorophenoxy)aniline structure
|
Common Name | 2-(3,5-dichlorophenoxy)aniline | ||
|---|---|---|---|---|
| CAS Number | 76838-75-0 | Molecular Weight | 254.11200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3,5-dichlorophenoxy)aniline |
|---|
| Molecular Formula | C12H9Cl2NO |
|---|---|
| Molecular Weight | 254.11200 |
| Exact Mass | 253.00600 |
| PSA | 35.25000 |
| LogP | 4.94910 |
| InChIKey | PKSRRBVQNAXVKN-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1Oc1cc(Cl)cc(Cl)c1 |
|
~90%
2-(3,5-dichloro... CAS#:76838-75-0 |
| Literature: STERIX LIMITED Patent: WO2007/3934 A2, 2007 ; Location in patent: Page/Page column 78 ; WO 2007/003934 A2 |
|
~%
2-(3,5-dichloro... CAS#:76838-75-0 |
| Literature: Golinske, Dirk; Voss, Juergen; Adiwidjaja, Gunadi Collection of Czechoslovak Chemical Communications, 2000 , vol. 65, # 6 p. 862 - 880 |
|
~%
2-(3,5-dichloro... CAS#:76838-75-0 |
| Literature: Golinske, Dirk; Voss, Juergen; Adiwidjaja, Gunadi Collection of Czechoslovak Chemical Communications, 2000 , vol. 65, # 6 p. 862 - 880 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |