1,5-Dithia-2,4,6,8-tetrazocine, 3,7-diphenyl
1,5-Dithia-2,4,6,8-tetrazocine, 3,7-diphenyl structure
|
Common Name | 1,5-Dithia-2,4,6,8-tetrazocine, 3,7-diphenyl | ||
|---|---|---|---|---|
| CAS Number | 76843-75-9 | Molecular Weight | 298.38600 | |
| Density | 1.354g/cm3 | Boiling Point | 426.257ºC at 760 mmHg | |
| Molecular Formula | C14H10N4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.593ºC | |
Summary: (3E)-3,7-Diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene, also known as 1,5-Dithia-2,4,6,8-tetrazocine, 3,7-diphenyl-, CAS号76843-75-9, molecular formula C14H10N4S2, molecular weight 298.38600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.354g/cm3 |
|---|---|
| Boiling Point | 426.257ºC at 760 mmHg |
| Molecular Formula | C14H10N4S2 |
| Molecular Weight | 298.38600 |
| Flash Point | 211.593ºC |
| Exact Mass | 298.03500 |
| PSA | 108.04000 |
| LogP | 3.84800 |
| Index of Refraction | 1.722 |
| InChIKey | DGZKXDKRIYGMML-XXSPVYAKSA-N |
| SMILES | c1ccc(C2=NSN=C(c3ccccc3)N=S=N2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 2 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,5-Dithia-2,4,6,8-tetrazocine,3,7-diphenyl |
| 3,7-diphenyl-1,5,2,4,6,8-dithiatetrazocine |
| 3,7-diphenyl-1,5-dithia-2,4,6,8-tetrazocine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene? |
| A: Boiling point of (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene is 426.257ºC at 760 mmHg. |
| Q: What is the molecular weight of (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene? |
| A: Molecular weight of (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene is 298.38600. |
| Q: What is the SMILES notation of (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene? |
| A: SMILES notation of (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene is c1ccc(C2=NSN=C(c3ccccc3)N=S=N2)cc1. |
| Q: What is the CAS number of (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene? |
| A: CAS number of (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene is 76843-75-9. |
| Q: What are the upstream materials of (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene? |
| A: Related upstream materials(CAS) of (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene: 618-39-3;67862-38-8;24261-90-3;100-47-0;4039-32-1;63481-05-0. |
| Q: What is the InChIKey of (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene? |
| A: InChIKey of (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene is DGZKXDKRIYGMML-XXSPVYAKSA-N. |
| Q: What is the LogP of (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene? |
| A: LogP of (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene is 3.84800. |
| Q: What is the English name of (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene? |
| A: The English name of (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene is (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene. |
| Q: What is the molecular formula of (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene? |
| A: Molecular formula of (3E)-3,7-diphenyl-1λ4,5-dithia-2,4,6,8-tetrazacycloocta-1,3,6,8-tetraene is C14H10N4S2. |
| Q: What is the Chinese name of 76843-75-9? |
| A: Chinese name of 76843-75-9 is 76843-75-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |