N-2-NITROPHENYLSULFENYL-L-LEUCINE
N-2-NITROPHENYLSULFENYL-L-LEUCINE structure
|
Common Name | N-2-NITROPHENYLSULFENYL-L-LEUCINE | ||
|---|---|---|---|---|
| CAS Number | 7685-67-8 | Molecular Weight | 284.33100 | |
| Density | 1.305g/cm3 | Boiling Point | 450.255ºC at 760 mmHg | |
| Molecular Formula | C12H16N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.107ºC | |
Summary: N-(2-Nitrophenylthio)-L-leucine, Chinese name: N-(2-硝基苯基硫代)-L-亮氨酸, CAS number: 7685-67-8, molecular formula: C12H16N2O4S, molecular weight: 284.33100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2-Nitrophenylthio)-L-leucine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.305g/cm3 |
|---|---|
| Boiling Point | 450.255ºC at 760 mmHg |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.33100 |
| Flash Point | 226.107ºC |
| Exact Mass | 284.08300 |
| PSA | 120.45000 |
| LogP | 3.60490 |
| Index of Refraction | -98 ° (C=2, DMF) |
| InChIKey | OITRGNOZDXVYFU-VIFPVBQESA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NSC1=CC=CC=C1[N+](=O)[O-] |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2930909090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-2-Nitrophenylsulfenyl-L-leucine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-(2-Nitrophenylthio)-L-leucine? |
| A: Molecular weight of N-(2-Nitrophenylthio)-L-leucine is 284.33100. |
| Q: What English synonyms does N-(2-Nitrophenylthio)-L-leucine have? |
| A: English synonyms of N-(2-Nitrophenylthio)-L-leucine: N-2-Nitrophenylsulfenyl-L-leucine. |
| Q: What is the CAS number of N-(2-Nitrophenylthio)-L-leucine? |
| A: CAS number of N-(2-Nitrophenylthio)-L-leucine is 7685-67-8. |
| Q: What is the boiling point of N-(2-Nitrophenylthio)-L-leucine? |
| A: Boiling point of N-(2-Nitrophenylthio)-L-leucine is 450.255ºC at 760 mmHg. |
| Q: What is the SMILES notation of N-(2-Nitrophenylthio)-L-leucine? |
| A: SMILES notation of N-(2-Nitrophenylthio)-L-leucine is CC(C)C[C@@H](C(=O)O)NSC1=CC=CC=C1[N+](=O)[O-]. |
| Q: What is the molecular formula of N-(2-Nitrophenylthio)-L-leucine? |
| A: Molecular formula of N-(2-Nitrophenylthio)-L-leucine is C12H16N2O4S. |
| Q: What is the polar surface area (PSA) of N-(2-Nitrophenylthio)-L-leucine? |
| A: Polar surface area (PSA) of N-(2-Nitrophenylthio)-L-leucine is 120.45000. |
| Q: What is the InChIKey of N-(2-Nitrophenylthio)-L-leucine? |
| A: InChIKey of N-(2-Nitrophenylthio)-L-leucine is OITRGNOZDXVYFU-VIFPVBQESA-N. |
| Q: What is the LogP of N-(2-Nitrophenylthio)-L-leucine? |
| A: LogP of N-(2-Nitrophenylthio)-L-leucine is 3.60490. |
| Q: What is the English name of N-(2-Nitrophenylthio)-L-leucine? |
| A: The English name of N-(2-Nitrophenylthio)-L-leucine is N-(2-Nitrophenylthio)-L-leucine. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |