(7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate
(7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate structure
|
Common Name | (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 76855-75-9 | Molecular Weight | 264.66100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (7-Chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate, CAS number: 76855-75-9, molecular formula: C13H9ClO4, molecular weight: 264.66100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H9ClO4 |
|---|---|
| Molecular Weight | 264.66100 |
| Exact Mass | 264.01900 |
| PSA | 60.44000 |
| LogP | 2.50370 |
| InChIKey | IZXROCXOPMZCBC-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1cccc2c1C(=O)C(Cl)=C(C)C2=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(7-chloro-6-met... CAS#:76855-75-9 |
| Literature: Wurm; Geres Archiv der Pharmazie, 1990 , vol. 323, # 6 p. 319 - 322 |
|
~%
(7-chloro-6-met... CAS#:76855-75-9 |
| Literature: Wurm, Gotthard; Geres, Uwe Archiv der Pharmazie (Weinheim, Germany), 1984 , vol. 317, # 7 p. 606 - 609 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:481-42-5
CAS#:21890-57-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Chlorplumbaginacetat |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate? |
| A: Molecular formula of (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate is C13H9ClO4. |
| Q: What is the Chinese name of 76855-75-9? |
| A: Chinese name of 76855-75-9 is 76855-75-9. |
| Q: What is the molecular weight of (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate? |
| A: Molecular weight of (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate is 264.66100. |
| Q: What is the InChIKey of (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate? |
| A: InChIKey of (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate is IZXROCXOPMZCBC-UHFFFAOYSA-N. |
| Q: What English synonyms does (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate have? |
| A: English synonyms of (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate: 3-Chlorplumbaginacetat. |
| Q: What is the LogP of (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate? |
| A: LogP of (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate is 2.50370. |
| Q: What is the CAS number of (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate? |
| A: CAS number of (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate is 76855-75-9. |
| Q: What is the polar surface area (PSA) of (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate? |
| A: Polar surface area (PSA) of (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate is 60.44000. |
| Q: What are the upstream materials of (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate? |
| A: Related upstream materials(CAS) of (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate: 67-68-5. |
| Q: What is the SMILES notation of (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate? |
| A: SMILES notation of (7-chloro-6-methyl-5,8-dioxonaphthalen-1-yl) acetate is CC(=O)Oc1cccc2c1C(=O)C(Cl)=C(C)C2=O. |