2-bis(4-fluorophenyl)phosphanylethyl-bis(4-fluorophenyl)phosphane
Modify Date: 2025-09-18 08:13:36
2-bis(4-fluorophenyl)phosphanylethyl-bis(4-fluorophenyl)phosphane structure
|
Common Name | 2-bis(4-fluorophenyl)phosphanylethyl-bis(4-fluorophenyl)phosphane | ||
|---|---|---|---|---|
| CAS Number | 76858-95-2 | Molecular Weight | 470.37800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H20F4P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bis(4-fluorophenyl)phosphanylethyl-bis(4-fluorophenyl)phosphane |
|---|
| Molecular Formula | C26H20F4P2 |
|---|---|
| Molecular Weight | 470.37800 |
| Exact Mass | 470.09800 |
| PSA | 27.18000 |
| LogP | 5.80860 |
| InChIKey | DDXWLUGLIWPEEO-UHFFFAOYSA-N |
| SMILES | Fc1ccc(P(CCP(c2ccc(F)cc2)c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Maximum increase in life span was determined against P388 leukemia at 4-5 doses of co...
Source: ChEMBL
Target: P388
External Id: CHEMBL762217
|
|
Name: In vitro cytotoxicity against murine B16 melanoma cells
Source: ChEMBL
Target: B16
External Id: CHEMBL652824
|
|
Name: Maximally tolerated dose was measured after ip administration of compound, 24 hr afte...
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL723207
|
Total 3, Current Page 1 of 1
1