Diazenecarboxylic acid,(3-chlorophenyl)-, ethyl ester, 2-oxide (9CI)
Diazenecarboxylic acid,(3-chlorophenyl)-, ethyl ester, 2-oxide (9CI) structure
|
Common Name | Diazenecarboxylic acid,(3-chlorophenyl)-, ethyl ester, 2-oxide (9CI) | ||
|---|---|---|---|---|
| CAS Number | 76869-80-2 | Molecular Weight | 228.63200 | |
| Density | 1.31g/cm3 | Boiling Point | 337.2ºC at 760 mmHg | |
| Molecular Formula | C9H9ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 337.2ºC at 760 mmHg |
| Molecular Formula | C9H9ClN2O3 |
| Molecular Weight | 228.63200 |
| Flash Point | 157.7ºC |
| Exact Mass | 228.03000 |
| PSA | 67.41000 |
| LogP | 3.61370 |
| Index of Refraction | 1.556 |
| InChIKey | QRPBASNIQSUADU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N=[N+]([O-])c1cccc(Cl)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~87%
Diazenecarboxyl... CAS#:76869-80-2 |
| Literature: Mortarini; Calvino; Gasco; et al. European Journal of Medicinal Chemistry, 1980 , vol. 15, # 5 p. 475 - 478 |
|
~%
Diazenecarboxyl... CAS#:76869-80-2 |
| Literature: Mortarini; Calvino; Gasco; et al. European Journal of Medicinal Chemistry, 1980 , vol. 15, # 5 p. 475 - 478 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 76869-80-2? |
| A: Chinese name of 76869-80-2 is 76869-80-2. |
| Q: What is the molecular weight of (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium? |
| A: Molecular weight of (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium is 228.63200. |
| Q: What is the English name of (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium? |
| A: The English name of (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium is (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium. |
| Q: What is the InChIKey of (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium? |
| A: InChIKey of (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium is QRPBASNIQSUADU-UHFFFAOYSA-N. |
| Q: What is the molecular formula of (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium? |
| A: Molecular formula of (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium is C9H9ClN2O3. |
| Q: What is the LogP of (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium? |
| A: LogP of (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium is 3.61370. |
| Q: What is the polar surface area (PSA) of (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium? |
| A: Polar surface area (PSA) of (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium is 67.41000. |
| Q: What is the SMILES notation of (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium? |
| A: SMILES notation of (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium is CCOC(=O)N=[N+]([O-])c1cccc(Cl)c1. |
| Q: What is the boiling point of (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium? |
| A: Boiling point of (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium is 337.2ºC at 760 mmHg. |
| Q: What are the upstream materials of (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium? |
| A: Related upstream materials(CAS) of (Z)-(3-chlorophenyl)-ethoxycarbonylimino-oxidoazanium: 76869-92-6;14763-20-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |