(1R,2R)-1,2-Bis((R)-2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diyl diacetate
Modify Date: 2026-07-09 12:05:25
(1R,2R)-1,2-Bis((R)-2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diyl diacetate structure
|
Common Name | (1R,2R)-1,2-Bis((R)-2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diyl diacetate | ||
|---|---|---|---|---|
| CAS Number | 76880-55-2 | Molecular Weight | 346.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H26O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1R,2R)-1,2-Bis((R)-2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diyl diacetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H26O8 |
|---|---|
| Molecular Weight | 346.37 |
| InChIKey | MMSXXHNYSBMWLI-AAVRWANBSA-N |
| SMILES | CC(=O)OC(C1COC(C)(C)O1)C(OC(C)=O)C1COC(C)(C)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (1R,2R)-1,2-Bis((R)-2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diyl diacetate? |
| A: The English name of (1R,2R)-1,2-Bis((R)-2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diyl diacetate is (1R,2R)-1,2-Bis((R)-2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diyl diacetate. |
| Q: What is the molecular weight of (1R,2R)-1,2-Bis((R)-2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diyl diacetate? |
| A: Molecular weight of (1R,2R)-1,2-Bis((R)-2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diyl diacetate is 346.37. |
| Q: What is the molecular formula of (1R,2R)-1,2-Bis((R)-2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diyl diacetate? |
| A: Molecular formula of (1R,2R)-1,2-Bis((R)-2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diyl diacetate is C16H26O8. |
| Q: What is the CAS number of (1R,2R)-1,2-Bis((R)-2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diyl diacetate? |
| A: CAS number of (1R,2R)-1,2-Bis((R)-2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diyl diacetate is 76880-55-2. |
| Q: What is the SMILES notation of (1R,2R)-1,2-Bis((R)-2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diyl diacetate? |
| A: SMILES notation of (1R,2R)-1,2-Bis((R)-2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diyl diacetate is CC(=O)OC(C1COC(C)(C)O1)C(OC(C)=O)C1COC(C)(C)O1. |
| Q: What is the InChIKey of (1R,2R)-1,2-Bis((R)-2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diyl diacetate? |
| A: InChIKey of (1R,2R)-1,2-Bis((R)-2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diyl diacetate is MMSXXHNYSBMWLI-AAVRWANBSA-N. |
| Q: What is the Chinese name of 76880-55-2? |
| A: Chinese name of 76880-55-2 is 76880-55-2. |