3-(3-Imidazol-1-ylmethyl-2-isopropyl-indol-1-yl)-propionic acid
Modify Date: 2025-10-06 18:55:01
3-(3-Imidazol-1-ylmethyl-2-isopropyl-indol-1-yl)-propionic acid structure
|
Common Name | 3-(3-Imidazol-1-ylmethyl-2-isopropyl-indol-1-yl)-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 76894-78-5 | Molecular Weight | 311.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(3-Imidazol-1-ylmethyl-2-isopropyl-indol-1-yl)-propionic acid |
|---|
| Molecular Formula | C18H21N3O2 |
|---|---|
| Molecular Weight | 311.4 |
| InChIKey | SWCVUCGNOPVPNZ-UHFFFAOYSA-N |
| SMILES | CC(C)c1c(Cn2ccnc2)c2ccccc2n1CCC(=O)O |
|
Name: Inhibition of PGI-2 synthetase from porcine aorta
Source: ChEMBL
Target: Prostacyclin synthase
External Id: CHEMBL765578
|
|
Name: Inhibition of TXA2 synthetase from human platelets
Source: ChEMBL
Target: Thromboxane-A synthase
External Id: CHEMBL815020
|
Total 2, Current Page 1 of 1
1