2-(4-Chloro-3-nitrophenyl)-4H-3,1-benzoxazin-4-one
2-(4-Chloro-3-nitrophenyl)-4H-3,1-benzoxazin-4-one structure
|
Common Name | 2-(4-Chloro-3-nitrophenyl)-4H-3,1-benzoxazin-4-one | ||
|---|---|---|---|---|
| CAS Number | 76903-72-5 | Molecular Weight | 302.66900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H7ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3'-Nitro-4'-chlorophenyl)quinazolin-4-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H7ClN2O4 |
|---|---|
| Molecular Weight | 302.66900 |
| Exact Mass | 302.00900 |
| PSA | 88.92000 |
| LogP | 3.93980 |
| InChIKey | ZYMZJDWJYQZCOX-UHFFFAOYSA-N |
| SMILES | O=c1oc(-c2ccc(Cl)c([N+](=O)[O-])c2)nc2ccccc12 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-(3'-Nitro-4'-chlorophenyl)quinazolin-4-one? |
| A: LogP of 2-(3'-Nitro-4'-chlorophenyl)quinazolin-4-one is 3.93980. |
| Q: What is the InChIKey of 2-(3'-Nitro-4'-chlorophenyl)quinazolin-4-one? |
| A: InChIKey of 2-(3'-Nitro-4'-chlorophenyl)quinazolin-4-one is ZYMZJDWJYQZCOX-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-(3'-Nitro-4'-chlorophenyl)quinazolin-4-one? |
| A: Molecular formula of 2-(3'-Nitro-4'-chlorophenyl)quinazolin-4-one is C14H7ClN2O4. |
| Q: What is the polar surface area (PSA) of 2-(3'-Nitro-4'-chlorophenyl)quinazolin-4-one? |
| A: Polar surface area (PSA) of 2-(3'-Nitro-4'-chlorophenyl)quinazolin-4-one is 88.92000. |
| Q: What is the CAS number of 2-(3'-Nitro-4'-chlorophenyl)quinazolin-4-one? |
| A: CAS number of 2-(3'-Nitro-4'-chlorophenyl)quinazolin-4-one is 76903-72-5. |
| Q: What is the Chinese name of 76903-72-5? |
| A: Chinese name of 76903-72-5 is 76903-72-5. |
| Q: What is the SMILES notation of 2-(3'-Nitro-4'-chlorophenyl)quinazolin-4-one? |
| A: SMILES notation of 2-(3'-Nitro-4'-chlorophenyl)quinazolin-4-one is O=c1oc(-c2ccc(Cl)c([N+](=O)[O-])c2)nc2ccccc12. |
| Q: What is the English name of 2-(3'-Nitro-4'-chlorophenyl)quinazolin-4-one? |
| A: The English name of 2-(3'-Nitro-4'-chlorophenyl)quinazolin-4-one is 2-(3'-Nitro-4'-chlorophenyl)quinazolin-4-one. |
| Q: What is the molecular weight of 2-(3'-Nitro-4'-chlorophenyl)quinazolin-4-one? |
| A: Molecular weight of 2-(3'-Nitro-4'-chlorophenyl)quinazolin-4-one is 302.66900. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |