3-Cyclopentene-1-carboxylic acid, 1-(chlorocarbonyl)-, ethyl ester (9CI) structure
|
Common Name | 3-Cyclopentene-1-carboxylic acid, 1-(chlorocarbonyl)-, ethyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 76910-09-3 | Molecular Weight | 202.63500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 1-carbonochloridoylcyclopent-3-ene-1-carboxylate |
|---|
| Molecular Formula | C9H11ClO3 |
|---|---|
| Molecular Weight | 202.63500 |
| Exact Mass | 202.04000 |
| PSA | 43.37000 |
| LogP | 1.65130 |
| InChIKey | JIYSWLYJVRUHHG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C(=O)Cl)CC=CC1 |
| HS Code | 2918990090 |
|---|
|
~92%
3-Cyclopentene-... CAS#:76910-09-3 |
| Literature: Paulsen, Hans; Maass, Uwe Chemische Berichte, 1981 , vol. 114, # 1 p. 346 - 358 |
|
~%
3-Cyclopentene-... CAS#:76910-09-3 |
| Literature: Paulsen, Hans; Maass, Uwe Chemische Berichte, 1981 , vol. 114, # 1 p. 346 - 358 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |