2-amino-3',6'-bis(dimethylamino)spiro[isoindole-3,9'-xanthene]-1-one structure
|
Common Name | 2-amino-3',6'-bis(dimethylamino)spiro[isoindole-3,9'-xanthene]-1-one | ||
|---|---|---|---|---|
| CAS Number | 76918-79-1 | Molecular Weight | 400.47300 | |
| Density | 1.36g/cm3 | Boiling Point | 611.8ºC at 760 mmHg | |
| Molecular Formula | C24H24N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.8ºC | |
| Name | 2-amino-3',6'-bis(dimethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 611.8ºC at 760 mmHg |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.47300 |
| Flash Point | 323.8ºC |
| Exact Mass | 400.19000 |
| PSA | 62.04000 |
| LogP | 4.18390 |
| Index of Refraction | 1.727 |
| InChIKey | LQWZPFXZYAVDSS-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc2c(c1)Oc1cc(N(C)C)ccc1C21c2ccccc2C(=O)N1N |
|
~%
2-amino-3',6'-b... CAS#:76918-79-1 |
| Literature: Kuzuya; Usui; Ito; et al. Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 12 p. 3561 - 3569 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| spiro[3,6-bis-(p-dimethylamino)-xanthene-9-3'-N-aminophthalimidine] |